C11H10Br2O — CID 87520921
2,2-dibromo-1-(2,3-dihydro-1H-inden-4-yl)ethanone (PubChem CID 87520921) has the molecular formula C11H10Br2O and a molecular weight of 318.01 g/mol. Its IUPAC name is 2,2-dibromo-1-(2,3-dihydro-1H-inden-4-yl)ethanone.
| Compound Name | 2,2-dibromo-1-(2,3-dihydro-1H-inden-4-yl)ethanone |
|---|---|
| PubChem CID | 87520921 |
| Molecular Formula | C11H10Br2O |
| Molecular Weight | 318.01 g/mol |
| Exact Mass | 315.91 |
| IUPAC Name | 2,2-dibromo-1-(2,3-dihydro-1H-inden-4-yl)ethanone |
| SMILES | O=C(c1cccc2c1CCC2)C(Br)Br |
| InChI | InChI=1S/C11H10Br2O/c12-11(13)10(14)9-6-2-4-7-3-1-5-8(7)9/h2,4,6,11H,1,3,5H2 |
| InChIKey | ICWHTFYREIBRMJ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.01 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|