2-(2,3-dihydro-1H-inden-4-yl)acetic acid

C11H12O2 — CID 15212214

IUPAC2-(2,3-dihydro-1H-inden-4-yl)acetic acid
SMILESO=C(O)Cc1cccc2c1CCC2
InChIInChI=1S/C11H12O2/c12-11(13)7-9-5-1-3-8-4-2-6-10(8)9/h1,3,5H,2,4,6-7H2,(H,12,13)
InChIKeyUTDVHUXMAILLIB-UHFFFAOYSA-N
MW176.21 g/mol
LogP1.80
Rot. Bonds2

About 2-(2,3-dihydro-1H-inden-4-yl)acetic acid

2-(2,3-dihydro-1H-inden-4-yl)acetic acid (PubChem CID 15212214) has the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-4-yl)acetic acid.

Molecular Properties

Compound Name2-(2,3-dihydro-1H-inden-4-yl)acetic acid
PubChem CID15212214
Molecular FormulaC11H12O2
Molecular Weight176.21 g/mol
Exact Mass176.08
IUPAC Name2-(2,3-dihydro-1H-inden-4-yl)acetic acid
SMILESO=C(O)Cc1cccc2c1CCC2
InChIInChI=1S/C11H12O2/c12-11(13)7-9-5-1-3-8-4-2-6-10(8)9/h1,3,5H,2,4,6-7H2,(H,12,13)
InChIKeyUTDVHUXMAILLIB-UHFFFAOYSA-N
XLogP1.80
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500176.21
LogP ≤ 51.80
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 2-(2,3-dihydro-1H-inden-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,3-dihydro-1H-inden-4-yl)acetic acid?
The IUPAC name of 2-(2,3-dihydro-1H-inden-4-yl)acetic acid (CID 15212214) is 2-(2,3-dihydro-1H-inden-4-yl)acetic acid.
What is the SMILES notation for 2-(2,3-dihydro-1H-inden-4-yl)acetic acid?
The canonical SMILES for 2-(2,3-dihydro-1H-inden-4-yl)acetic acid is O=C(O)Cc1cccc2c1CCC2.
What is the InChIKey of 2-(2,3-dihydro-1H-inden-4-yl)acetic acid?
The InChIKey is UTDVHUXMAILLIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2/c12-11(13)7-9-5-1-3-8-4-2-6-10(8)9/h1,3,5H,2,4,6-7H2,(H,12,13).
What are the key properties of 2-(2,3-dihydro-1H-inden-4-yl)acetic acid?
2-(2,3-dihydro-1H-inden-4-yl)acetic acid has a molecular weight of 176.21 g/mol, XLogP of 1.80, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydro-1H-inden-4-yl)acetic acid is sourced from PubChem (CID 15212214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).