C27H32O4 — CID 54556119
dimethyl 2,2-bis(5,6,7,8-tetrahydronaphthalen-1-ylmethyl)propanedioate (PubChem CID 54556119) has the molecular formula C27H32O4 and a molecular weight of 420.55 g/mol. Its IUPAC name is dimethyl 2,2-bis(5,6,7,8-tetrahydronaphthalen-1-ylmethyl)propanedioate.
| Compound Name | dimethyl 2,2-bis(5,6,7,8-tetrahydronaphthalen-1-ylmethyl)propanedioate |
|---|---|
| PubChem CID | 54556119 |
| Molecular Formula | C27H32O4 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.23 |
| IUPAC Name | dimethyl 2,2-bis(5,6,7,8-tetrahydronaphthalen-1-ylmethyl)propanedioate |
| SMILES | COC(=O)C(Cc1cccc2c1CCCC2)(Cc1cccc2c1CCCC2)C(=O)OC |
| InChI | InChI=1S/C27H32O4/c1-30-25(28)27(26(29)31-2,17-21-13-7-11-19-9-3-5-15-23(19)21)18-22-14-8-12-20-10-4-6-16-24(20)22/h7-8,11-14H,3-6,9-10,15-18H2,1-2H3 |
| InChIKey | ZNGYYZHMYHRIJA-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|