C12H16O2 — CID 140617334
5,6,7,8-tetrahydronaphthalen-1-ylmethoxymethanol (PubChem CID 140617334) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 5,6,7,8-tetrahydronaphthalen-1-ylmethoxymethanol.
| Compound Name | 5,6,7,8-tetrahydronaphthalen-1-ylmethoxymethanol |
|---|---|
| PubChem CID | 140617334 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 5,6,7,8-tetrahydronaphthalen-1-ylmethoxymethanol |
| SMILES | OCOCc1cccc2c1CCCC2 |
| InChI | InChI=1S/C12H16O2/c13-9-14-8-11-6-3-5-10-4-1-2-7-12(10)11/h3,5-6,13H,1-2,4,7-9H2 |
| InChIKey | QOQSWVPFMSGWCR-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|