C10H11NS — CID 151070386
2,3-dihydro-1H-indene-4-carbothioamide (PubChem CID 151070386) has the molecular formula C10H11NS and a molecular weight of 177.27 g/mol. Its IUPAC name is 2,3-dihydro-1H-indene-4-carbothioamide.
| Compound Name | 2,3-dihydro-1H-indene-4-carbothioamide |
|---|---|
| PubChem CID | 151070386 |
| Molecular Formula | C10H11NS |
| Molecular Weight | 177.27 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 2,3-dihydro-1H-indene-4-carbothioamide |
| SMILES | NC(=S)c1cccc2c1CCC2 |
| InChI | InChI=1S/C10H11NS/c11-10(12)9-6-2-4-7-3-1-5-8(7)9/h2,4,6H,1,3,5H2,(H2,11,12) |
| InChIKey | MIAANUKZGKWKSZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|