C20H22 — CID 91804905
tetracyclo[11.7.0.02,10.03,8]icosa-1(13),2(10),3,5,7,11-hexaene (PubChem CID 91804905) has the molecular formula C20H22 and a molecular weight of 262.40 g/mol. Its IUPAC name is tetracyclo[11.7.0.02,10.03,8]icosa-1(13),2(10),3,5,7,11-hexaene.
| Compound Name | tetracyclo[11.7.0.02,10.03,8]icosa-1(13),2(10),3,5,7,11-hexaene |
|---|---|
| PubChem CID | 91804905 |
| Molecular Formula | C20H22 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | tetracyclo[11.7.0.02,10.03,8]icosa-1(13),2(10),3,5,7,11-hexaene |
| SMILES | c1ccc2c(c1)Cc1ccc3c(c1-2)CCCCCCC3 |
| InChI | InChI=1S/C20H22/c1-2-4-8-15-12-13-17-14-16-9-6-7-11-19(16)20(17)18(15)10-5-3-1/h6-7,9,11-13H,1-5,8,10,14H2 |
| InChIKey | LWLSUTYOPJAWPA-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |