C10H11BF3- — CID 63677195
trifluoro(5,6,7,8-tetrahydronaphthalen-1-yl)boranuide (PubChem CID 63677195) has the molecular formula C10H11BF3- and a molecular weight of 199.00 g/mol. Its IUPAC name is trifluoro(5,6,7,8-tetrahydronaphthalen-1-yl)boranuide.
| Compound Name | trifluoro(5,6,7,8-tetrahydronaphthalen-1-yl)boranuide |
|---|---|
| PubChem CID | 63677195 |
| Molecular Formula | C10H11BF3- |
| Molecular Weight | 199.00 g/mol |
| Exact Mass | 199.09 |
| IUPAC Name | trifluoro(5,6,7,8-tetrahydronaphthalen-1-yl)boranuide |
| SMILES | F[B-](F)(F)c1cccc2c1CCCC2 |
| InChI | InChI=1S/C10H11BF3/c12-11(13,14)10-7-3-5-8-4-1-2-6-9(8)10/h3,5,7H,1-2,4,6H2/q-1 |
| InChIKey | WRSUYSWJPDXNFH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.00 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|