C11H13OP — CID 154973128
4-phosphoroso-6,7,8,9-tetrahydro-5H-benzo[7]annulene (PubChem CID 154973128) has the molecular formula C11H13OP and a molecular weight of 192.20 g/mol. Its IUPAC name is 4-phosphoroso-6,7,8,9-tetrahydro-5H-benzo[7]annulene.
| Compound Name | 4-phosphoroso-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
|---|---|
| PubChem CID | 154973128 |
| Molecular Formula | C11H13OP |
| Molecular Weight | 192.20 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 4-phosphoroso-6,7,8,9-tetrahydro-5H-benzo[7]annulene |
| SMILES | O=Pc1cccc2c1CCCCC2 |
| InChI | InChI=1S/C11H13OP/c12-13-11-8-4-6-9-5-2-1-3-7-10(9)11/h4,6,8H,1-3,5,7H2 |
| InChIKey | DNJXHUTYRIPAHU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.20 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|