C11H12F2 — CID 159912774
5-(difluoromethyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 159912774) has the molecular formula C11H12F2 and a molecular weight of 182.21 g/mol. Its IUPAC name is 5-(difluoromethyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 5-(difluoromethyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 159912774 |
| Molecular Formula | C11H12F2 |
| Molecular Weight | 182.21 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 5-(difluoromethyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | FC(F)c1cccc2c1CCCC2 |
| InChI | InChI=1S/C11H12F2/c12-11(13)10-7-3-5-8-4-1-2-6-9(8)10/h3,5,7,11H,1-2,4,6H2 |
| InChIKey | KZOHXZORYMKUNF-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.21 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |