2,3-dihydro-1H-inden-4-yl(fluoro)methanesulfinic acid

C10H11FO2S — CID 174959439

IUPAC2,3-dihydro-1H-inden-4-yl(fluoro)methanesulfinic acid
SMILESO=S(O)C(F)c1cccc2c1CCC2
InChIInChI=1S/C10H11FO2S/c11-10(14(12)13)9-6-2-4-7-3-1-5-8(7)9/h2,4,6,10H,1,3,5H2,(H,12,13)
InChIKeySZKUJTOBMZXYTF-UHFFFAOYSA-N
MW214.26 g/mol
LogP2.37
Rot. Bonds2

About 2,3-dihydro-1H-inden-4-yl(fluoro)methanesulfinic acid

2,3-dihydro-1H-inden-4-yl(fluoro)methanesulfinic acid (PubChem CID 174959439) has the molecular formula C10H11FO2S and a molecular weight of 214.26 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-4-yl(fluoro)methanesulfinic acid.

Molecular Properties

Compound Name2,3-dihydro-1H-inden-4-yl(fluoro)methanesulfinic acid
PubChem CID174959439
Molecular FormulaC10H11FO2S
Molecular Weight214.26 g/mol
Exact Mass214.05
IUPAC Name2,3-dihydro-1H-inden-4-yl(fluoro)methanesulfinic acid
SMILESO=S(O)C(F)c1cccc2c1CCC2
InChIInChI=1S/C10H11FO2S/c11-10(14(12)13)9-6-2-4-7-3-1-5-8(7)9/h2,4,6,10H,1,3,5H2,(H,12,13)
InChIKeySZKUJTOBMZXYTF-UHFFFAOYSA-N
XLogP2.37
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.26
LogP ≤ 52.37
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}

Analyze 2,3-dihydro-1H-inden-4-yl(fluoro)methanesulfinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dihydro-1H-inden-4-yl(fluoro)methanesulfinic acid?
The IUPAC name of 2,3-dihydro-1H-inden-4-yl(fluoro)methanesulfinic acid (CID 174959439) is 2,3-dihydro-1H-inden-4-yl(fluoro)methanesulfinic acid.
What is the SMILES notation for 2,3-dihydro-1H-inden-4-yl(fluoro)methanesulfinic acid?
The canonical SMILES for 2,3-dihydro-1H-inden-4-yl(fluoro)methanesulfinic acid is O=S(O)C(F)c1cccc2c1CCC2.
What is the InChIKey of 2,3-dihydro-1H-inden-4-yl(fluoro)methanesulfinic acid?
The InChIKey is SZKUJTOBMZXYTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11FO2S/c11-10(14(12)13)9-6-2-4-7-3-1-5-8(7)9/h2,4,6,10H,1,3,5H2,(H,12,13).
What are the key properties of 2,3-dihydro-1H-inden-4-yl(fluoro)methanesulfinic acid?
2,3-dihydro-1H-inden-4-yl(fluoro)methanesulfinic acid has a molecular weight of 214.26 g/mol, XLogP of 2.37, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydro-1H-inden-4-yl(fluoro)methanesulfinic acid is sourced from PubChem (CID 174959439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).