C10H11FO2S — CID 174959439
2,3-dihydro-1H-inden-4-yl(fluoro)methanesulfinic acid (PubChem CID 174959439) has the molecular formula C10H11FO2S and a molecular weight of 214.26 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-4-yl(fluoro)methanesulfinic acid.
| Compound Name | 2,3-dihydro-1H-inden-4-yl(fluoro)methanesulfinic acid |
|---|---|
| PubChem CID | 174959439 |
| Molecular Formula | C10H11FO2S |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 2,3-dihydro-1H-inden-4-yl(fluoro)methanesulfinic acid |
| SMILES | O=S(O)C(F)c1cccc2c1CCC2 |
| InChI | InChI=1S/C10H11FO2S/c11-10(14(12)13)9-6-2-4-7-3-1-5-8(7)9/h2,4,6,10H,1,3,5H2,(H,12,13) |
| InChIKey | SZKUJTOBMZXYTF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|