C13H19N — CID 130644887
(1S)-1-(5,6,7,8-tetrahydronaphthalen-1-yl)propan-1-amine (PubChem CID 130644887) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is (1S)-1-(5,6,7,8-tetrahydronaphthalen-1-yl)propan-1-amine.
| Compound Name | (1S)-1-(5,6,7,8-tetrahydronaphthalen-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 130644887 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | (1S)-1-(5,6,7,8-tetrahydronaphthalen-1-yl)propan-1-amine |
| SMILES | CC[C@H](N)c1cccc2c1CCCC2 |
| InChI | InChI=1S/C13H19N/c1-2-13(14)12-9-5-7-10-6-3-4-8-11(10)12/h5,7,9,13H,2-4,6,8,14H2,1H3/t13-/m0/s1 |
| InChIKey | APSVOULVPIYYRU-ZDUSSCGKSA-N |
| XLogP | 2.98 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |