C10H10FO2S- — CID 174959438
2,3-dihydro-1H-inden-4-yl(fluoro)methanesulfinate (PubChem CID 174959438) has the molecular formula C10H10FO2S- and a molecular weight of 213.25 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-4-yl(fluoro)methanesulfinate.
| Compound Name | 2,3-dihydro-1H-inden-4-yl(fluoro)methanesulfinate |
|---|---|
| PubChem CID | 174959438 |
| Molecular Formula | C10H10FO2S- |
| Molecular Weight | 213.25 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 2,3-dihydro-1H-inden-4-yl(fluoro)methanesulfinate |
| SMILES | O=S([O-])C(F)c1cccc2c1CCC2 |
| InChI | InChI=1S/C10H11FO2S/c11-10(14(12)13)9-6-2-4-7-3-1-5-8(7)9/h2,4,6,10H,1,3,5H2,(H,12,13)/p-1 |
| InChIKey | SZKUJTOBMZXYTF-UHFFFAOYSA-M |
| XLogP | 2.02 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.25 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|