About 2-propylphenolate;zirconium(2+);chloride
2-propylphenolate;zirconium(2+);chloride (PubChem CID 22137017) has the molecular formula C9H11ClOZr
and a molecular weight of 261.86 g/mol. Its IUPAC name is 2-propylphenolate;zirconium(2+);chloride.
Molecular Properties
| Compound Name | 2-propylphenolate;zirconium(2+);chloride |
| PubChem CID | 22137017 |
| Molecular Formula | C9H11ClOZr |
| Molecular Weight | 261.86 g/mol |
| Exact Mass | 259.95 |
| IUPAC Name | 2-propylphenolate;zirconium(2+);chloride |
| SMILES | CCCc1ccccc1[O-].[Cl-].[Zr+2] |
| InChI | InChI=1S/C9H12O.ClH.Zr/c1-2-5-8-6-3-4-7-9(8)10;;/h3-4,6-7,10H,2,5H2,1H3;1H;/q;;+2/p-2 |
| InChIKey | QTIDFJFSGZDFRS-UHFFFAOYSA-L |
| XLogP | -1.29 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.86 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-propylphenolate;zirconium(2+);chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylphenolate;zirconium(2+);chloride?
The IUPAC name of 2-propylphenolate;zirconium(2+);chloride (CID 22137017) is 2-propylphenolate;zirconium(2+);chloride.
What is the SMILES notation for 2-propylphenolate;zirconium(2+);chloride?
The canonical SMILES for 2-propylphenolate;zirconium(2+);chloride is CCCc1ccccc1[O-].[Cl-].[Zr+2].
What is the InChIKey of 2-propylphenolate;zirconium(2+);chloride?
The InChIKey is QTIDFJFSGZDFRS-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H12O.ClH.Zr/c1-2-5-8-6-3-4-7-9(8)10;;/h3-4,6-7,10H,2,5H2,1H3;1H;/q;;+2/p-2.
What are the key properties of 2-propylphenolate;zirconium(2+);chloride?
2-propylphenolate;zirconium(2+);chloride has a molecular weight of 261.86 g/mol, XLogP of -1.29, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylphenolate;zirconium(2+);chloride is sourced from PubChem (CID 22137017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).