About 3,6-dipropylbenzene-1,2-diolate;nickel(2+)
3,6-dipropylbenzene-1,2-diolate;nickel(2+) (PubChem CID 160952514) has the molecular formula C12H16NiO2
and a molecular weight of 250.95 g/mol. Its IUPAC name is 3,6-dipropylbenzene-1,2-diolate;nickel(2+).
Molecular Properties
| Compound Name | 3,6-dipropylbenzene-1,2-diolate;nickel(2+) |
| PubChem CID | 160952514 |
| Molecular Formula | C12H16NiO2 |
| Molecular Weight | 250.95 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 3,6-dipropylbenzene-1,2-diolate;nickel(2+) |
| SMILES | CCCc1ccc(CCC)c([O-])c1[O-].[Ni+2] |
| InChI | InChI=1S/C12H18O2.Ni/c1-3-5-9-7-8-10(6-4-2)12(14)11(9)13;/h7-8,13-14H,3-6H2,1-2H3;/q;+2/p-2 |
| InChIKey | SVYIKAVKUDZFHE-UHFFFAOYSA-L |
| XLogP | 1.74 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.95 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,6-dipropylbenzene-1,2-diolate;nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dipropylbenzene-1,2-diolate;nickel(2+)?
The IUPAC name of 3,6-dipropylbenzene-1,2-diolate;nickel(2+) (CID 160952514) is 3,6-dipropylbenzene-1,2-diolate;nickel(2+).
What is the SMILES notation for 3,6-dipropylbenzene-1,2-diolate;nickel(2+)?
The canonical SMILES for 3,6-dipropylbenzene-1,2-diolate;nickel(2+) is CCCc1ccc(CCC)c([O-])c1[O-].[Ni+2].
What is the InChIKey of 3,6-dipropylbenzene-1,2-diolate;nickel(2+)?
The InChIKey is SVYIKAVKUDZFHE-UHFFFAOYSA-L. The full InChI is InChI=1S/C12H18O2.Ni/c1-3-5-9-7-8-10(6-4-2)12(14)11(9)13;/h7-8,13-14H,3-6H2,1-2H3;/q;+2/p-2.
What are the key properties of 3,6-dipropylbenzene-1,2-diolate;nickel(2+)?
3,6-dipropylbenzene-1,2-diolate;nickel(2+) has a molecular weight of 250.95 g/mol, XLogP of 1.74, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dipropylbenzene-1,2-diolate;nickel(2+) is sourced from PubChem (CID 160952514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).