About 4-(4-methylphenyl)-1,2-dipropylbenzene
4-(4-methylphenyl)-1,2-dipropylbenzene (PubChem CID 159068290) has the molecular formula C19H24
and a molecular weight of 252.40 g/mol. Its IUPAC name is 4-(4-methylphenyl)-1,2-dipropylbenzene.
Molecular Properties
| Compound Name | 4-(4-methylphenyl)-1,2-dipropylbenzene |
| PubChem CID | 159068290 |
| Molecular Formula | C19H24 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 4-(4-methylphenyl)-1,2-dipropylbenzene |
| SMILES | CCCc1ccc(-c2ccc(C)cc2)cc1CCC |
| InChI | InChI=1S/C19H24/c1-4-6-16-12-13-19(14-18(16)7-5-2)17-10-8-15(3)9-11-17/h8-14H,4-7H2,1-3H3 |
| InChIKey | VOOXRRYVKDRFCR-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 4-(4-methylphenyl)-1,2-dipropylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylphenyl)-1,2-dipropylbenzene?
The IUPAC name of 4-(4-methylphenyl)-1,2-dipropylbenzene (CID 159068290) is 4-(4-methylphenyl)-1,2-dipropylbenzene.
What is the SMILES notation for 4-(4-methylphenyl)-1,2-dipropylbenzene?
The canonical SMILES for 4-(4-methylphenyl)-1,2-dipropylbenzene is CCCc1ccc(-c2ccc(C)cc2)cc1CCC.
What is the InChIKey of 4-(4-methylphenyl)-1,2-dipropylbenzene?
The InChIKey is VOOXRRYVKDRFCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24/c1-4-6-16-12-13-19(14-18(16)7-5-2)17-10-8-15(3)9-11-17/h8-14H,4-7H2,1-3H3.
What are the key properties of 4-(4-methylphenyl)-1,2-dipropylbenzene?
4-(4-methylphenyl)-1,2-dipropylbenzene has a molecular weight of 252.40 g/mol, XLogP of 5.57, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylphenyl)-1,2-dipropylbenzene is sourced from PubChem (CID 159068290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).