C19H24 — CID 159068290
4-(4-methylphenyl)-1,2-dipropylbenzene (PubChem CID 159068290) has the molecular formula C19H24 and a molecular weight of 252.40 g/mol. Its IUPAC name is 4-(4-methylphenyl)-1,2-dipropylbenzene.
| Compound Name | 4-(4-methylphenyl)-1,2-dipropylbenzene |
|---|---|
| PubChem CID | 159068290 |
| Molecular Formula | C19H24 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 4-(4-methylphenyl)-1,2-dipropylbenzene |
| SMILES | CCCc1ccc(-c2ccc(C)cc2)cc1CCC |
| InChI | InChI=1S/C19H24/c1-4-6-16-12-13-19(14-18(16)7-5-2)17-10-8-15(3)9-11-17/h8-14H,4-7H2,1-3H3 |
| InChIKey | VOOXRRYVKDRFCR-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |