C12H16NiO2 — CID 157209919
3-ethyl-4-methyl-5-propylbenzene-1,2-diolate;nickel(2+) (PubChem CID 157209919) has the molecular formula C12H16NiO2 and a molecular weight of 250.95 g/mol. Its IUPAC name is 3-ethyl-4-methyl-5-propylbenzene-1,2-diolate;nickel(2+).
| Compound Name | 3-ethyl-4-methyl-5-propylbenzene-1,2-diolate;nickel(2+) |
|---|---|
| PubChem CID | 157209919 |
| Molecular Formula | C12H16NiO2 |
| Molecular Weight | 250.95 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 3-ethyl-4-methyl-5-propylbenzene-1,2-diolate;nickel(2+) |
| SMILES | CCCc1cc([O-])c([O-])c(CC)c1C.[Ni+2] |
| InChI | InChI=1S/C12H18O2.Ni/c1-4-6-9-7-11(13)12(14)10(5-2)8(9)3;/h7,13-14H,4-6H2,1-3H3;/q;+2/p-2 |
| InChIKey | ARTUITFPQKCJKZ-UHFFFAOYSA-L |
| XLogP | 1.65 |
| TPSA | 46.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.95 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |