About 1H-inden-4-amine;methanamine
1H-inden-4-amine;methanamine (PubChem CID 174766313) has the molecular formula C12H24N4
and a molecular weight of 224.35 g/mol. Its IUPAC name is 1H-inden-4-amine;methanamine.
Molecular Properties
| Compound Name | 1H-inden-4-amine;methanamine |
| PubChem CID | 174766313 |
| Molecular Formula | C12H24N4 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.20 |
| IUPAC Name | 1H-inden-4-amine;methanamine |
| SMILES | CN.CN.CN.Nc1cccc2c1C=CC2 |
| InChI | InChI=1S/C9H9N.3CH5N/c10-9-6-2-4-7-3-1-5-8(7)9;3*1-2/h1-2,4-6H,3,10H2;3*2H2,1H3 |
| InChIKey | LFMVMIIGTUYMFX-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 104.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1H-inden-4-amine;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-inden-4-amine;methanamine?
The IUPAC name of 1H-inden-4-amine;methanamine (CID 174766313) is 1H-inden-4-amine;methanamine.
What is the SMILES notation for 1H-inden-4-amine;methanamine?
The canonical SMILES for 1H-inden-4-amine;methanamine is CN.CN.CN.Nc1cccc2c1C=CC2.
What is the InChIKey of 1H-inden-4-amine;methanamine?
The InChIKey is LFMVMIIGTUYMFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N.3CH5N/c10-9-6-2-4-7-3-1-5-8(7)9;3*1-2/h1-2,4-6H,3,10H2;3*2H2,1H3.
What are the key properties of 1H-inden-4-amine;methanamine?
1H-inden-4-amine;methanamine has a molecular weight of 224.35 g/mol, XLogP of 0.56, 0 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-inden-4-amine;methanamine is sourced from PubChem (CID 174766313), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).