About 2-propylaniline
2-propylaniline (PubChem CID 15759) has the molecular formula C9H13N
and a molecular weight of 135.21 g/mol. Its IUPAC name is 2-propylaniline.
Molecular Properties
| Compound Name | 2-propylaniline |
| PubChem CID | 15759 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 2-propylaniline |
| SMILES | CCCc1ccccc1N |
| InChI | InChI=1S/C9H13N/c1-2-5-8-6-3-4-7-9(8)10/h3-4,6-7H,2,5,10H2,1H3 |
| InChIKey | WKURVXXDGMYSDP-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-propylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylaniline?
The IUPAC name of 2-propylaniline (CID 15759) is 2-propylaniline.
What is the SMILES notation for 2-propylaniline?
The canonical SMILES for 2-propylaniline is CCCc1ccccc1N.
What is the InChIKey of 2-propylaniline?
The InChIKey is WKURVXXDGMYSDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N/c1-2-5-8-6-3-4-7-9(8)10/h3-4,6-7H,2,5,10H2,1H3.
What are the key properties of 2-propylaniline?
2-propylaniline has a molecular weight of 135.21 g/mol, XLogP of 2.22, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylaniline is sourced from PubChem (CID 15759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).