C40H50N2 — CID 157267257
ethane;5-methyl-6H-indeno[2,1-b]indole;5-methyl-10H-indeno[1,2-b]indole (PubChem CID 157267257) has the molecular formula C40H50N2 and a molecular weight of 558.85 g/mol. Its IUPAC name is ethane;5-methyl-6H-indeno[2,1-b]indole;5-methyl-10H-indeno[1,2-b]indole.
| Compound Name | ethane;5-methyl-6H-indeno[2,1-b]indole;5-methyl-10H-indeno[1,2-b]indole |
|---|---|
| PubChem CID | 157267257 |
| Molecular Formula | C40H50N2 |
| Molecular Weight | 558.85 g/mol |
| Exact Mass | 558.40 |
| IUPAC Name | ethane;5-methyl-6H-indeno[2,1-b]indole;5-methyl-10H-indeno[1,2-b]indole |
| SMILES | CC.CC.CC.CC.Cn1c2c(c3ccccc31)-c1ccccc1C2.Cn1c2c(c3ccccc31)Cc1ccccc1-2 |
| InChI | InChI=1S/2C16H13N.4C2H6/c1-17-15-9-5-4-8-13(15)14-10-11-6-2-3-7-12(11)16(14)17;1-17-14-9-5-4-8-13(14)16-12-7-3-2-6-11(12)10-15(16)17;4*1-2/h2*2-9H,10H2,1H3;4*1-2H3 |
| InChIKey | AYDFONSWXULQRA-UHFFFAOYSA-N |
| XLogP | 11.60 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.85 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |