C16H21N3O — CID 23327272
(1R,14R,15R)-14-ethyl-3-methyl-16-oxa-3,13-diazatetracyclo[11.2.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraen-15-amine (PubChem CID 23327272) has the molecular formula C16H21N3O and a molecular weight of 271.36 g/mol. Its IUPAC name is (1R,14R,15R)-14-ethyl-3-methyl-16-oxa-3,13-diazatetracyclo[11.2.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraen-15-amine.
| Compound Name | (1R,14R,15R)-14-ethyl-3-methyl-16-oxa-3,13-diazatetracyclo[11.2.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraen-15-amine |
|---|---|
| PubChem CID | 23327272 |
| Molecular Formula | C16H21N3O |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | (1R,14R,15R)-14-ethyl-3-methyl-16-oxa-3,13-diazatetracyclo[11.2.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraen-15-amine |
| SMILES | CC[C@@H]1[C@@H](N)[C@H]2ON1CCc1c2n(C)c2ccccc12 |
| InChI | InChI=1S/C16H21N3O/c1-3-12-14(17)16-15-11(8-9-19(12)20-16)10-6-4-5-7-13(10)18(15)2/h4-7,12,14,16H,3,8-9,17H2,1-2H3/t12-,14-,16-/m1/s1 |
| InChIKey | ZUFYFLKCEDJLOY-XNRPHZJLSA-N |
| XLogP | 2.13 |
| TPSA | 43.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |