C17H23N3 — CID 54197338
4-ethyl-8-methyl-4,8,10-triazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),11,13,15-tetraene (PubChem CID 54197338) has the molecular formula C17H23N3 and a molecular weight of 269.39 g/mol. Its IUPAC name is 4-ethyl-8-methyl-4,8,10-triazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),11,13,15-tetraene.
| Compound Name | 4-ethyl-8-methyl-4,8,10-triazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),11,13,15-tetraene |
|---|---|
| PubChem CID | 54197338 |
| Molecular Formula | C17H23N3 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.19 |
| IUPAC Name | 4-ethyl-8-methyl-4,8,10-triazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),11,13,15-tetraene |
| SMILES | CCN1CCc2c3n(c4ccccc24)CN(C)CCC31 |
| InChI | InChI=1S/C17H23N3/c1-3-19-11-8-14-13-6-4-5-7-15(13)20-12-18(2)10-9-16(19)17(14)20/h4-7,16H,3,8-12H2,1-2H3 |
| InChIKey | PMTPZWOZHKCLMN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|