C17H20N2O — CID 23336496
4-ethyl-4,10-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),11,13,15-tetraen-9-one (PubChem CID 23336496) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 4-ethyl-4,10-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),11,13,15-tetraen-9-one.
| Compound Name | 4-ethyl-4,10-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),11,13,15-tetraen-9-one |
|---|---|
| PubChem CID | 23336496 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 4-ethyl-4,10-diazatetracyclo[8.6.1.05,17.011,16]heptadeca-1(17),11,13,15-tetraen-9-one |
| SMILES | CCN1CCc2c3n(c4ccccc24)C(=O)CCCC31 |
| InChI | InChI=1S/C17H20N2O/c1-2-18-11-10-13-12-6-3-4-7-14(12)19-16(20)9-5-8-15(18)17(13)19/h3-4,6-7,15H,2,5,8-11H2,1H3 |
| InChIKey | DLBSBYQWDNVMAV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |