C20H24N2O — CID 159268452
15-ethyl-14-methyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-17-one (PubChem CID 159268452) has the molecular formula C20H24N2O and a molecular weight of 308.42 g/mol. Its IUPAC name is 15-ethyl-14-methyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-17-one.
| Compound Name | 15-ethyl-14-methyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-17-one |
|---|---|
| PubChem CID | 159268452 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 15-ethyl-14-methyl-1,11-diazapentacyclo[9.6.2.02,7.08,18.015,19]nonadeca-2,4,6,8(18)-tetraen-17-one |
| SMILES | CCC12CC(=O)n3c4c(c5ccccc53)CCN(CCC1C)C42 |
| InChI | InChI=1S/C20H24N2O/c1-3-20-12-17(23)22-16-7-5-4-6-14(16)15-9-11-21(10-8-13(20)2)19(20)18(15)22/h4-7,13,19H,3,8-12H2,1-2H3 |
| InChIKey | MKPTXJYQFFYAOR-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |