C21H27NO — CID 142989435
(4S,5S)-4-butyl-4-ethyl-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraen-2-one (PubChem CID 142989435) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is (4S,5S)-4-butyl-4-ethyl-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraen-2-one.
| Compound Name | (4S,5S)-4-butyl-4-ethyl-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraen-2-one |
|---|---|
| PubChem CID | 142989435 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (4S,5S)-4-butyl-4-ethyl-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraen-2-one |
| SMILES | CCCC[C@@]1(CC)CC(=O)n2c3c(c4ccccc42)CCC[C@H]31 |
| InChI | InChI=1S/C21H27NO/c1-3-5-13-21(4-2)14-19(23)22-18-12-7-6-9-15(18)16-10-8-11-17(21)20(16)22/h6-7,9,12,17H,3-5,8,10-11,13-14H2,1-2H3/t17-,21+/m1/s1 |
| InChIKey | FFFRSYGYGZDJSF-UTKZUKDTSA-N |
| XLogP | 5.69 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |