C22H26N2O5 — CID 122368125
methyl (5R,8S)-5-butyl-8-(methoxyamino)-2,7-dioxo-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraene-8-carboxylate (PubChem CID 122368125) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is methyl (5R,8S)-5-butyl-8-(methoxyamino)-2,7-dioxo-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraene-8-carboxylate.
| Compound Name | methyl (5R,8S)-5-butyl-8-(methoxyamino)-2,7-dioxo-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraene-8-carboxylate |
|---|---|
| PubChem CID | 122368125 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | methyl (5R,8S)-5-butyl-8-(methoxyamino)-2,7-dioxo-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-9(16),10,12,14-tetraene-8-carboxylate |
| SMILES | CCCC[C@]12CCC(=O)n3c1c(c1ccccc13)[C@@](NOC)(C(=O)OC)C(=O)C2 |
| InChI | InChI=1S/C22H26N2O5/c1-4-5-11-21-12-10-17(26)24-15-9-7-6-8-14(15)18(19(21)24)22(23-29-3,16(25)13-21)20(27)28-2/h6-9,23H,4-5,10-13H2,1-3H3/t21-,22-/m1/s1 |
| InChIKey | YLFADFRFJUAWOP-FGZHOGPDSA-N |
| XLogP | 3.00 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|