C17H21NO3 — CID 134945040
methyl (2S,4E)-4-benzylidene-2-butyl-5-oxopyrrolidine-2-carboxylate (PubChem CID 134945040) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is methyl (2S,4E)-4-benzylidene-2-butyl-5-oxopyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4E)-4-benzylidene-2-butyl-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 134945040 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | methyl (2S,4E)-4-benzylidene-2-butyl-5-oxopyrrolidine-2-carboxylate |
| SMILES | CCCC[C@@]1(C(=O)OC)C/C(=C\c2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C17H21NO3/c1-3-4-10-17(16(20)21-2)12-14(15(19)18-17)11-13-8-6-5-7-9-13/h5-9,11H,3-4,10,12H2,1-2H3,(H,18,19)/b14-11+/t17-/m0/s1 |
| InChIKey | OITNVZOAZVXUNJ-WKOYGUFESA-N |
| XLogP | 2.69 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|