C14H13NO4 — CID 12619210
methyl (5E)-5-benzylidene-4-methoxy-2-oxopyrrole-3-carboxylate (PubChem CID 12619210) has the molecular formula C14H13NO4 and a molecular weight of 259.26 g/mol. Its IUPAC name is methyl (5E)-5-benzylidene-4-methoxy-2-oxopyrrole-3-carboxylate.
| Compound Name | methyl (5E)-5-benzylidene-4-methoxy-2-oxopyrrole-3-carboxylate |
|---|---|
| PubChem CID | 12619210 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | methyl (5E)-5-benzylidene-4-methoxy-2-oxopyrrole-3-carboxylate |
| SMILES | COC(=O)C1=C(OC)/C(=C\c2ccccc2)NC1=O |
| InChI | InChI=1S/C14H13NO4/c1-18-12-10(8-9-6-4-3-5-7-9)15-13(16)11(12)14(17)19-2/h3-8H,1-2H3,(H,15,16)/b10-8+ |
| InChIKey | QMKDALKCLJNMKN-CSKARUKUSA-N |
| XLogP | 1.23 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|