C19H19NO9 — CID 10982356
dimethyl 2-(4-methoxy-5-methoxycarbonyl-3,6-dioxo-2-phenyl-1H-pyridin-2-yl)propanedioate (PubChem CID 10982356) has the molecular formula C19H19NO9 and a molecular weight of 405.36 g/mol. Its IUPAC name is dimethyl 2-(4-methoxy-5-methoxycarbonyl-3,6-dioxo-2-phenyl-1H-pyridin-2-yl)propanedioate.
| Compound Name | dimethyl 2-(4-methoxy-5-methoxycarbonyl-3,6-dioxo-2-phenyl-1H-pyridin-2-yl)propanedioate |
|---|---|
| PubChem CID | 10982356 |
| Molecular Formula | C19H19NO9 |
| Molecular Weight | 405.36 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | dimethyl 2-(4-methoxy-5-methoxycarbonyl-3,6-dioxo-2-phenyl-1H-pyridin-2-yl)propanedioate |
| SMILES | COC(=O)C1=C(OC)C(=O)C(c2ccccc2)(C(C(=O)OC)C(=O)OC)NC1=O |
| InChI | InChI=1S/C19H19NO9/c1-26-13-11(16(23)27-2)15(22)20-19(14(13)21,10-8-6-5-7-9-10)12(17(24)28-3)18(25)29-4/h5-9,12H,1-4H3,(H,20,22) |
| InChIKey | BGGVHYARQDHTGV-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.36 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|