C21H30O2Si — CID 101130874
methyl (1R,4Z)-3-methylidene-1-phenyl-4-(triethylsilylmethylidene)cyclopentane-1-carboxylate (PubChem CID 101130874) has the molecular formula C21H30O2Si and a molecular weight of 342.56 g/mol. Its IUPAC name is methyl (1R,4Z)-3-methylidene-1-phenyl-4-(triethylsilylmethylidene)cyclopentane-1-carboxylate.
| Compound Name | methyl (1R,4Z)-3-methylidene-1-phenyl-4-(triethylsilylmethylidene)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 101130874 |
| Molecular Formula | C21H30O2Si |
| Molecular Weight | 342.56 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | methyl (1R,4Z)-3-methylidene-1-phenyl-4-(triethylsilylmethylidene)cyclopentane-1-carboxylate |
| SMILES | C=C1C[C@](C(=O)OC)(c2ccccc2)C/C1=C/[Si](CC)(CC)CC |
| InChI | InChI=1S/C21H30O2Si/c1-6-24(7-2,8-3)16-18-15-21(14-17(18)4,20(22)23-5)19-12-10-9-11-13-19/h9-13,16H,4,6-8,14-15H2,1-3,5H3/b18-16-/t21-/m1/s1 |
| InChIKey | AWWBGRSUVCBGAX-VUANCPLDSA-N |
| XLogP | 5.42 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.56 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|