C20H25NO3 — CID 134945023
methyl (2S,4E)-2-benzyl-4-(cyclohexylmethylidene)-5-oxopyrrolidine-2-carboxylate (PubChem CID 134945023) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is methyl (2S,4E)-2-benzyl-4-(cyclohexylmethylidene)-5-oxopyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4E)-2-benzyl-4-(cyclohexylmethylidene)-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 134945023 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | methyl (2S,4E)-2-benzyl-4-(cyclohexylmethylidene)-5-oxopyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@]1(Cc2ccccc2)C/C(=C\C2CCCCC2)C(=O)N1 |
| InChI | InChI=1S/C20H25NO3/c1-24-19(23)20(13-16-10-6-3-7-11-16)14-17(18(22)21-20)12-15-8-4-2-5-9-15/h3,6-7,10-12,15H,2,4-5,8-9,13-14H2,1H3,(H,21,22)/b17-12+/t20-/m0/s1 |
| InChIKey | IBWUFOZRZFLXNV-KZFLWGQDSA-N |
| XLogP | 3.17 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|