C18H19NO5 — CID 135033462
dimethyl 7,10-dimethyl-6-oxo-7,8-dihydropyrido[1,2-a]indole-9,9-dicarboxylate (PubChem CID 135033462) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is dimethyl 7,10-dimethyl-6-oxo-7,8-dihydropyrido[1,2-a]indole-9,9-dicarboxylate.
| Compound Name | dimethyl 7,10-dimethyl-6-oxo-7,8-dihydropyrido[1,2-a]indole-9,9-dicarboxylate |
|---|---|
| PubChem CID | 135033462 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | dimethyl 7,10-dimethyl-6-oxo-7,8-dihydropyrido[1,2-a]indole-9,9-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(C)C(=O)n2c1c(C)c1ccccc12 |
| InChI | InChI=1S/C18H19NO5/c1-10-9-18(16(21)23-3,17(22)24-4)14-11(2)12-7-5-6-8-13(12)19(14)15(10)20/h5-8,10H,9H2,1-4H3 |
| InChIKey | AVHZLIAMWBRTHL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|