C21H19NO4 — CID 122381045
dimethyl 1-methyl-2H-phenanthro[9,10-b]pyrrole-3,3-dicarboxylate (PubChem CID 122381045) has the molecular formula C21H19NO4 and a molecular weight of 349.39 g/mol. Its IUPAC name is dimethyl 1-methyl-2H-phenanthro[9,10-b]pyrrole-3,3-dicarboxylate.
| Compound Name | dimethyl 1-methyl-2H-phenanthro[9,10-b]pyrrole-3,3-dicarboxylate |
|---|---|
| PubChem CID | 122381045 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | dimethyl 1-methyl-2H-phenanthro[9,10-b]pyrrole-3,3-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CN(C)c2c1c1ccccc1c1ccccc21 |
| InChI | InChI=1S/C21H19NO4/c1-22-12-21(19(23)25-2,20(24)26-3)17-15-10-6-4-8-13(15)14-9-5-7-11-16(14)18(17)22/h4-11H,12H2,1-3H3 |
| InChIKey | OJMTXQGQMHBLLL-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|