C19H19NO4 — CID 122381044
dimethyl 3-methyl-3-azatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),2(6),7,11(15),12-pentaene-5,5-dicarboxylate (PubChem CID 122381044) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is dimethyl 3-methyl-3-azatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),2(6),7,11(15),12-pentaene-5,5-dicarboxylate.
| Compound Name | dimethyl 3-methyl-3-azatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),2(6),7,11(15),12-pentaene-5,5-dicarboxylate |
|---|---|
| PubChem CID | 122381044 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | dimethyl 3-methyl-3-azatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),2(6),7,11(15),12-pentaene-5,5-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CN(C)c2c1cc1c3c(cccc23)CC1 |
| InChI | InChI=1S/C19H19NO4/c1-20-10-19(17(21)23-2,18(22)24-3)14-9-12-8-7-11-5-4-6-13(15(11)12)16(14)20/h4-6,9H,7-8,10H2,1-3H3 |
| InChIKey | AOFAYXYBRMENEU-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|