C17H15NO2 — CID 46183128
methyl 3-methyl-5-azatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),2(6),3,7,11(15),12-hexaene-4-carboxylate (PubChem CID 46183128) has the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. Its IUPAC name is methyl 3-methyl-5-azatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),2(6),3,7,11(15),12-hexaene-4-carboxylate.
| Compound Name | methyl 3-methyl-5-azatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),2(6),3,7,11(15),12-hexaene-4-carboxylate |
|---|---|
| PubChem CID | 46183128 |
| Molecular Formula | C17H15NO2 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | methyl 3-methyl-5-azatetracyclo[6.6.1.02,6.011,15]pentadeca-1(14),2(6),3,7,11(15),12-hexaene-4-carboxylate |
| SMILES | COC(=O)c1[nH]c2cc3c4c(cccc4c2c1C)CC3 |
| InChI | InChI=1S/C17H15NO2/c1-9-14-12-5-3-4-10-6-7-11(15(10)12)8-13(14)18-16(9)17(19)20-2/h3-5,8,18H,6-7H2,1-2H3 |
| InChIKey | CIFVJHUPTWMXKF-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |