C22H17NO2 — CID 46183361
methyl 3-(1,2-dihydroacenaphthylen-5-yl)-1H-indole-2-carboxylate (PubChem CID 46183361) has the molecular formula C22H17NO2 and a molecular weight of 327.38 g/mol. Its IUPAC name is methyl 3-(1,2-dihydroacenaphthylen-5-yl)-1H-indole-2-carboxylate.
| Compound Name | methyl 3-(1,2-dihydroacenaphthylen-5-yl)-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 46183361 |
| Molecular Formula | C22H17NO2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | methyl 3-(1,2-dihydroacenaphthylen-5-yl)-1H-indole-2-carboxylate |
| SMILES | COC(=O)c1[nH]c2ccccc2c1-c1ccc2c3c(cccc13)CC2 |
| InChI | InChI=1S/C22H17NO2/c1-25-22(24)21-20(17-6-2-3-8-18(17)23-21)16-12-11-14-10-9-13-5-4-7-15(16)19(13)14/h2-8,11-12,23H,9-10H2,1H3 |
| InChIKey | VTSJBNCWTAAFDJ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |