C15H16O5S — CID 132933445
dimethyl 5-oxo-2-phenylthiane-4,4-dicarboxylate (PubChem CID 132933445) has the molecular formula C15H16O5S and a molecular weight of 308.36 g/mol. Its IUPAC name is dimethyl 5-oxo-2-phenylthiane-4,4-dicarboxylate.
| Compound Name | dimethyl 5-oxo-2-phenylthiane-4,4-dicarboxylate |
|---|---|
| PubChem CID | 132933445 |
| Molecular Formula | C15H16O5S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | dimethyl 5-oxo-2-phenylthiane-4,4-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(c2ccccc2)SCC1=O |
| InChI | InChI=1S/C15H16O5S/c1-19-13(17)15(14(18)20-2)8-11(21-9-12(15)16)10-6-4-3-5-7-10/h3-7,11H,8-9H2,1-2H3 |
| InChIKey | RWNQULFKIMPFOW-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|