C20H18N2O4 — CID 102498568
dimethyl 2-amino-3-cyano-4-naphthalen-1-ylcyclopent-2-ene-1,1-dicarboxylate (PubChem CID 102498568) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is dimethyl 2-amino-3-cyano-4-naphthalen-1-ylcyclopent-2-ene-1,1-dicarboxylate.
| Compound Name | dimethyl 2-amino-3-cyano-4-naphthalen-1-ylcyclopent-2-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102498568 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | dimethyl 2-amino-3-cyano-4-naphthalen-1-ylcyclopent-2-ene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(c2cccc3ccccc23)C(C#N)=C1N |
| InChI | InChI=1S/C20H18N2O4/c1-25-18(23)20(19(24)26-2)10-15(16(11-21)17(20)22)14-9-5-7-12-6-3-4-8-13(12)14/h3-9,15H,10,22H2,1-2H3 |
| InChIKey | TVLHMEGNEDHOOC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 102.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|