C20H16N2O2 — CID 101382998
ethyl 4,4-dicyano-5-naphthalen-1-ylcyclopentene-1-carboxylate (PubChem CID 101382998) has the molecular formula C20H16N2O2 and a molecular weight of 316.36 g/mol. Its IUPAC name is ethyl 4,4-dicyano-5-naphthalen-1-ylcyclopentene-1-carboxylate.
| Compound Name | ethyl 4,4-dicyano-5-naphthalen-1-ylcyclopentene-1-carboxylate |
|---|---|
| PubChem CID | 101382998 |
| Molecular Formula | C20H16N2O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | ethyl 4,4-dicyano-5-naphthalen-1-ylcyclopentene-1-carboxylate |
| SMILES | CCOC(=O)C1=CCC(C#N)(C#N)C1c1cccc2ccccc12 |
| InChI | InChI=1S/C20H16N2O2/c1-2-24-19(23)17-10-11-20(12-21,13-22)18(17)16-9-5-7-14-6-3-4-8-15(14)16/h3-10,18H,2,11H2,1H3 |
| InChIKey | RPJLEYHEAAHDQZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 73.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |