C22H23NO9 — CID 154722290
2-[9,9-bis(methoxycarbonyl)-7-(3-methoxy-3-oxopropyl)-6-oxo-7,8-dihydropyrido[1,2-a]indol-10-yl]acetic acid (PubChem CID 154722290) has the molecular formula C22H23NO9 and a molecular weight of 445.42 g/mol. Its IUPAC name is 2-[9,9-bis(methoxycarbonyl)-7-(3-methoxy-3-oxopropyl)-6-oxo-7,8-dihydropyrido[1,2-a]indol-10-yl]acetic acid.
| Compound Name | 2-[9,9-bis(methoxycarbonyl)-7-(3-methoxy-3-oxopropyl)-6-oxo-7,8-dihydropyrido[1,2-a]indol-10-yl]acetic acid |
|---|---|
| PubChem CID | 154722290 |
| Molecular Formula | C22H23NO9 |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 2-[9,9-bis(methoxycarbonyl)-7-(3-methoxy-3-oxopropyl)-6-oxo-7,8-dihydropyrido[1,2-a]indol-10-yl]acetic acid |
| SMILES | COC(=O)CCC1CC(C(=O)OC)(C(=O)OC)c2c(CC(=O)O)c3ccccc3n2C1=O |
| InChI | InChI=1S/C22H23NO9/c1-30-17(26)9-8-12-11-22(20(28)31-2,21(29)32-3)18-14(10-16(24)25)13-6-4-5-7-15(13)23(18)19(12)27/h4-7,12H,8-11H2,1-3H3,(H,24,25) |
| InChIKey | MJSMAPCSGSHROR-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|