C21H18N2O6 — CID 175177820
2-[2-methoxy-1-oxo-3-(2-oxo-2-phenoxyethyl)-3H-imidazo[1,5-a]indol-4-yl]acetic acid (PubChem CID 175177820) has the molecular formula C21H18N2O6 and a molecular weight of 394.38 g/mol. Its IUPAC name is 2-[2-methoxy-1-oxo-3-(2-oxo-2-phenoxyethyl)-3H-imidazo[1,5-a]indol-4-yl]acetic acid.
| Compound Name | 2-[2-methoxy-1-oxo-3-(2-oxo-2-phenoxyethyl)-3H-imidazo[1,5-a]indol-4-yl]acetic acid |
|---|---|
| PubChem CID | 175177820 |
| Molecular Formula | C21H18N2O6 |
| Molecular Weight | 394.38 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 2-[2-methoxy-1-oxo-3-(2-oxo-2-phenoxyethyl)-3H-imidazo[1,5-a]indol-4-yl]acetic acid |
| SMILES | CON1C(=O)n2c(c(CC(=O)O)c3ccccc32)C1CC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C21H18N2O6/c1-28-23-17(12-19(26)29-13-7-3-2-4-8-13)20-15(11-18(24)25)14-9-5-6-10-16(14)22(20)21(23)27/h2-10,17H,11-12H2,1H3,(H,24,25) |
| InChIKey | OSWDDFDCZFUZPH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 98.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|