C21H17NO7S — CID 15274941
dimethyl 5-methylsulfonyl-11-oxobenzo[b]carbazole-6,6-dicarboxylate (PubChem CID 15274941) has the molecular formula C21H17NO7S and a molecular weight of 427.43 g/mol. Its IUPAC name is dimethyl 5-methylsulfonyl-11-oxobenzo[b]carbazole-6,6-dicarboxylate.
| Compound Name | dimethyl 5-methylsulfonyl-11-oxobenzo[b]carbazole-6,6-dicarboxylate |
|---|---|
| PubChem CID | 15274941 |
| Molecular Formula | C21H17NO7S |
| Molecular Weight | 427.43 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | dimethyl 5-methylsulfonyl-11-oxobenzo[b]carbazole-6,6-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)c2ccccc2C(=O)c2c1n(S(C)(=O)=O)c1ccccc21 |
| InChI | InChI=1S/C21H17NO7S/c1-28-19(24)21(20(25)29-2)14-10-6-4-8-12(14)17(23)16-13-9-5-7-11-15(13)22(18(16)21)30(3,26)27/h4-11H,1-3H3 |
| InChIKey | YAYYSJWAMCHPHD-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 108.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|