C21H16ClNO7S — CID 15274945
dimethyl 8-chloro-5-methylsulfonyl-11-oxobenzo[b]carbazole-6,6-dicarboxylate (PubChem CID 15274945) has the molecular formula C21H16ClNO7S and a molecular weight of 461.88 g/mol. Its IUPAC name is dimethyl 8-chloro-5-methylsulfonyl-11-oxobenzo[b]carbazole-6,6-dicarboxylate.
| Compound Name | dimethyl 8-chloro-5-methylsulfonyl-11-oxobenzo[b]carbazole-6,6-dicarboxylate |
|---|---|
| PubChem CID | 15274945 |
| Molecular Formula | C21H16ClNO7S |
| Molecular Weight | 461.88 g/mol |
| Exact Mass | 461.03 |
| IUPAC Name | dimethyl 8-chloro-5-methylsulfonyl-11-oxobenzo[b]carbazole-6,6-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)c2cc(Cl)ccc2C(=O)c2c1n(S(C)(=O)=O)c1ccccc21 |
| InChI | InChI=1S/C21H16ClNO7S/c1-29-19(25)21(20(26)30-2)14-10-11(22)8-9-12(14)17(24)16-13-6-4-5-7-15(13)23(18(16)21)31(3,27)28/h4-10H,1-3H3 |
| InChIKey | NXHPPKWQNMLVRZ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 108.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.88 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|