C12H10ClNO5 — CID 125471489
dimethyl 6-chloro-3-oxo-2H-isoindole-1,1-dicarboxylate (PubChem CID 125471489) has the molecular formula C12H10ClNO5 and a molecular weight of 283.67 g/mol. Its IUPAC name is dimethyl 6-chloro-3-oxo-2H-isoindole-1,1-dicarboxylate.
| Compound Name | dimethyl 6-chloro-3-oxo-2H-isoindole-1,1-dicarboxylate |
|---|---|
| PubChem CID | 125471489 |
| Molecular Formula | C12H10ClNO5 |
| Molecular Weight | 283.67 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | dimethyl 6-chloro-3-oxo-2H-isoindole-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)NC(=O)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C12H10ClNO5/c1-18-10(16)12(11(17)19-2)8-5-6(13)3-4-7(8)9(15)14-12/h3-5H,1-2H3,(H,14,15) |
| InChIKey | FFUJSKAPIUUANK-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.67 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|