methyl 1-(2,4-dichlorophenyl)cyclopentane-1-carboxylate

C13H14Cl2O2 — CID 3454678

IUPACmethyl 1-(2,4-dichlorophenyl)cyclopentane-1-carboxylate
SMILESCOC(=O)C1(c2ccc(Cl)cc2Cl)CCCC1
InChIInChI=1S/C13H14Cl2O2/c1-17-12(16)13(6-2-3-7-13)10-5-4-9(14)8-11(10)15/h4-5,8H,2-3,6-7H2,1H3
InChIKeyQMIPQTULPOPEBX-UHFFFAOYSA-N
MW273.16 g/mol
LogP3.98
Rot. Bonds2

About methyl 1-(2,4-dichlorophenyl)cyclopentane-1-carboxylate

methyl 1-(2,4-dichlorophenyl)cyclopentane-1-carboxylate (PubChem CID 3454678) has the molecular formula C13H14Cl2O2 and a molecular weight of 273.16 g/mol. Its IUPAC name is methyl 1-(2,4-dichlorophenyl)cyclopentane-1-carboxylate.

Molecular Properties

Compound Namemethyl 1-(2,4-dichlorophenyl)cyclopentane-1-carboxylate
PubChem CID3454678
Molecular FormulaC13H14Cl2O2
Molecular Weight273.16 g/mol
Exact Mass272.04
IUPAC Namemethyl 1-(2,4-dichlorophenyl)cyclopentane-1-carboxylate
SMILESCOC(=O)C1(c2ccc(Cl)cc2Cl)CCCC1
InChIInChI=1S/C13H14Cl2O2/c1-17-12(16)13(6-2-3-7-13)10-5-4-9(14)8-11(10)15/h4-5,8H,2-3,6-7H2,1H3
InChIKeyQMIPQTULPOPEBX-UHFFFAOYSA-N
XLogP3.98
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.16
LogP ≤ 53.98
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze methyl 1-(2,4-dichlorophenyl)cyclopentane-1-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-(2,4-dichlorophenyl)cyclopentane-1-carboxylate?
The IUPAC name of methyl 1-(2,4-dichlorophenyl)cyclopentane-1-carboxylate (CID 3454678) is methyl 1-(2,4-dichlorophenyl)cyclopentane-1-carboxylate.
What is the SMILES notation for methyl 1-(2,4-dichlorophenyl)cyclopentane-1-carboxylate?
The canonical SMILES for methyl 1-(2,4-dichlorophenyl)cyclopentane-1-carboxylate is COC(=O)C1(c2ccc(Cl)cc2Cl)CCCC1.
What is the InChIKey of methyl 1-(2,4-dichlorophenyl)cyclopentane-1-carboxylate?
The InChIKey is QMIPQTULPOPEBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14Cl2O2/c1-17-12(16)13(6-2-3-7-13)10-5-4-9(14)8-11(10)15/h4-5,8H,2-3,6-7H2,1H3.
What are the key properties of methyl 1-(2,4-dichlorophenyl)cyclopentane-1-carboxylate?
methyl 1-(2,4-dichlorophenyl)cyclopentane-1-carboxylate has a molecular weight of 273.16 g/mol, XLogP of 3.98, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(2,4-dichlorophenyl)cyclopentane-1-carboxylate is sourced from PubChem (CID 3454678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).