C12H12Cl2O3 — CID 66436974
methyl 3-(2,4-dichlorophenyl)-2,3-dimethyloxirane-2-carboxylate (PubChem CID 66436974) has the molecular formula C12H12Cl2O3 and a molecular weight of 275.13 g/mol. Its IUPAC name is methyl 3-(2,4-dichlorophenyl)-2,3-dimethyloxirane-2-carboxylate.
| Compound Name | methyl 3-(2,4-dichlorophenyl)-2,3-dimethyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 66436974 |
| Molecular Formula | C12H12Cl2O3 |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | methyl 3-(2,4-dichlorophenyl)-2,3-dimethyloxirane-2-carboxylate |
| SMILES | COC(=O)C1(C)OC1(C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C12H12Cl2O3/c1-11(12(2,17-11)10(15)16-3)8-5-4-7(13)6-9(8)14/h4-6H,1-3H3 |
| InChIKey | CPAFGMMEOREFSB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|