C12H13ClO3 — CID 66437174
methyl 3-(3-chlorophenyl)-2,3-dimethyloxirane-2-carboxylate (PubChem CID 66437174) has the molecular formula C12H13ClO3 and a molecular weight of 240.69 g/mol. Its IUPAC name is methyl 3-(3-chlorophenyl)-2,3-dimethyloxirane-2-carboxylate.
| Compound Name | methyl 3-(3-chlorophenyl)-2,3-dimethyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 66437174 |
| Molecular Formula | C12H13ClO3 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | methyl 3-(3-chlorophenyl)-2,3-dimethyloxirane-2-carboxylate |
| SMILES | COC(=O)C1(C)OC1(C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C12H13ClO3/c1-11(8-5-4-6-9(13)7-8)12(2,16-11)10(14)15-3/h4-7H,1-3H3 |
| InChIKey | JDGYUFHKSLPQQX-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|