C12H13ClO2S — CID 117035077
methyl 1-(3-chlorophenyl)sulfanylcyclobutane-1-carboxylate (PubChem CID 117035077) has the molecular formula C12H13ClO2S and a molecular weight of 256.75 g/mol. Its IUPAC name is methyl 1-(3-chlorophenyl)sulfanylcyclobutane-1-carboxylate.
| Compound Name | methyl 1-(3-chlorophenyl)sulfanylcyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 117035077 |
| Molecular Formula | C12H13ClO2S |
| Molecular Weight | 256.75 g/mol |
| Exact Mass | 256.03 |
| IUPAC Name | methyl 1-(3-chlorophenyl)sulfanylcyclobutane-1-carboxylate |
| SMILES | COC(=O)C1(Sc2cccc(Cl)c2)CCC1 |
| InChI | InChI=1S/C12H13ClO2S/c1-15-11(14)12(6-3-7-12)16-10-5-2-4-9(13)8-10/h2,4-5,8H,3,6-7H2,1H3 |
| InChIKey | BGWGNAOJIYXIMB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.75 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |