C16H22ClNO2 — CID 63524804
methyl 1-(3-chloroanilino)-4-ethylcyclohexane-1-carboxylate (PubChem CID 63524804) has the molecular formula C16H22ClNO2 and a molecular weight of 295.81 g/mol. Its IUPAC name is methyl 1-(3-chloroanilino)-4-ethylcyclohexane-1-carboxylate.
| Compound Name | methyl 1-(3-chloroanilino)-4-ethylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 63524804 |
| Molecular Formula | C16H22ClNO2 |
| Molecular Weight | 295.81 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | methyl 1-(3-chloroanilino)-4-ethylcyclohexane-1-carboxylate |
| SMILES | CCC1CCC(Nc2cccc(Cl)c2)(C(=O)OC)CC1 |
| InChI | InChI=1S/C16H22ClNO2/c1-3-12-7-9-16(10-8-12,15(19)20-2)18-14-6-4-5-13(17)11-14/h4-6,11-12,18H,3,7-10H2,1-2H3 |
| InChIKey | QKPUNYRCQUFRHX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.81 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |