C17H24ClNO2 — CID 65085708
methyl 1-(3-chloroanilino)-4,4-dimethylcycloheptane-1-carboxylate (PubChem CID 65085708) has the molecular formula C17H24ClNO2 and a molecular weight of 309.84 g/mol. Its IUPAC name is methyl 1-(3-chloroanilino)-4,4-dimethylcycloheptane-1-carboxylate.
| Compound Name | methyl 1-(3-chloroanilino)-4,4-dimethylcycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 65085708 |
| Molecular Formula | C17H24ClNO2 |
| Molecular Weight | 309.84 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | methyl 1-(3-chloroanilino)-4,4-dimethylcycloheptane-1-carboxylate |
| SMILES | COC(=O)C1(Nc2cccc(Cl)c2)CCCC(C)(C)CC1 |
| InChI | InChI=1S/C17H24ClNO2/c1-16(2)8-5-9-17(11-10-16,15(20)21-3)19-14-7-4-6-13(18)12-14/h4,6-7,12,19H,5,8-11H2,1-3H3 |
| InChIKey | TZNBYCMKRRLQES-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.84 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |