C28H26ClNO3 — CID 164582326
methyl 1-(3-chloroanilino)-2'-(3-hydroxyphenyl)spiro[cyclohexane-4,1'-indene]-1-carboxylate (PubChem CID 164582326) has the molecular formula C28H26ClNO3 and a molecular weight of 459.97 g/mol. Its IUPAC name is methyl 1-(3-chloroanilino)-2'-(3-hydroxyphenyl)spiro[cyclohexane-4,1'-indene]-1-carboxylate.
| Compound Name | methyl 1-(3-chloroanilino)-2'-(3-hydroxyphenyl)spiro[cyclohexane-4,1'-indene]-1-carboxylate |
|---|---|
| PubChem CID | 164582326 |
| Molecular Formula | C28H26ClNO3 |
| Molecular Weight | 459.97 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | methyl 1-(3-chloroanilino)-2'-(3-hydroxyphenyl)spiro[cyclohexane-4,1'-indene]-1-carboxylate |
| SMILES | COC(=O)C1(Nc2cccc(Cl)c2)CCC2(CC1)C(c1cccc(O)c1)=Cc1ccccc12 |
| InChI | InChI=1S/C28H26ClNO3/c1-33-26(32)28(30-22-9-5-8-21(29)18-22)14-12-27(13-15-28)24-11-3-2-6-20(24)17-25(27)19-7-4-10-23(31)16-19/h2-11,16-18,30-31H,12-15H2,1H3 |
| InChIKey | BPYYETTUGUMRPZ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.97 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|